EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | [H]C(=CC(=O)O)CC |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h3-4H,2H2,1H3,(H,6,7) |
| InChIKey | YIYBQIKDCADOSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pent-2-enoic acid (CHEBI:35939) is a pentenoic acid (CHEBI:25897) |
| pent-2-enoic acid (CHEBI:35939) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| pent-2-enoic acid (CHEBI:35939) is conjugate acid of pent-2-enoate (CHEBI:231930) |
| Incoming Relation(s) |
| cis-acetylacrylic acid (CHEBI:28993) has functional parent pent-2-enoic acid (CHEBI:35939) |
| ethyl (2E,4S)-4-[((2R)-2-{[N-(tert-butoxycarbonyl)-L-valyl]amino}-2-phenylethanoyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (CHEBI:42367) has functional parent pent-2-enoic acid (CHEBI:35939) |
| cis-pent-2-enoic acid (CHEBI:38367) is a pent-2-enoic acid (CHEBI:35939) |
| trans-pent-2-enoic acid (CHEBI:38366) is a pent-2-enoic acid (CHEBI:35939) |
| pent-2-enoate (CHEBI:231930) is conjugate base of pent-2-enoic acid (CHEBI:35939) |
| IUPAC Name |
|---|
| pent-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-pentenoic acid | NIST Chemistry WebBook |
| C5:1, n-3 | ChEBI |
| Pent-2-ensäure | ChEBI |
| Propylidenessigsäure | ChEBI |
| α-Butylen-α-carbonsäure | ChEBI |
| α-pentenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB010036 | FooDB |
| LMFA01030005 | LIPID MAPS |
| Citations |
|---|