EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | CC/C=C\C(=O)O |
| InChI | InChI=1S/C5H8O2/c1-2-3-4-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3- |
| InChIKey | YIYBQIKDCADOSF-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-pent-2-enoic acid (CHEBI:38367) is a pent-2-enoic acid (CHEBI:35939) |
| IUPAC Name |
|---|
| (2Z)-pent-2-enoic acid |
| Synonyms | Source |
|---|---|
| C5:1, n-3 cis | ChEBI |
| cis-2-pentenoic acid | ChEBI |
| cis-Pent-2-ensäure | ChEBI |
| cis-α,β-penteneoic acid | NIST Chemistry WebBook |
| cis-β-Aethylacrylsäure | ChEBI |
| Z-2-Pentencarbonsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720311 | Reaxys |
| CAS:16666-42-5 | NIST Chemistry WebBook |