EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6NO4 |
| Net Charge | -1 |
| Average Mass | 144.106 |
| Monoisotopic Mass | 144.03023 |
| SMILES | NC(=O)C(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C5H7NO4/c6-5(10)3(7)1-2-4(8)9/h1-2H2,(H2,6,10)(H,8,9)/p-1 |
| InChIKey | UGKYJAWJZICPEX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxoglutaramate (CHEBI:27467) has functional parent glutaramate (CHEBI:35908) |
| 4-oxoglutaramate (CHEBI:27467) is a 4-oxo monocarboxylic acid anion (CHEBI:35974) |
| 4-oxoglutaramate (CHEBI:27467) is conjugate base of 4-oxoglutaramic acid (CHEBI:30883) |
| Incoming Relation(s) |
| 4-oxoglutaramic acid (CHEBI:30883) is conjugate acid of 4-oxoglutaramate (CHEBI:27467) |
| IUPAC Name |
|---|
| 5-amino-4,5-dioxopentanoate |
| Synonym | Source |
|---|---|
| 4-ketoglutaramate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05572 | KEGG COMPOUND |