EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N |
| Net Charge | 0 |
| Average Mass | 213.324 |
| Monoisotopic Mass | 213.15175 |
| SMILES | [H][C@]12CCC[C@@]3([H])c4ccccc4CN(CC1)[C@]23[H] |
| InChI | InChI=1S/C15H19N/c1-2-6-13-12(4-1)10-16-9-8-11-5-3-7-14(13)15(11)16/h1-2,4,6,11,14-15H,3,5,7-10H2/t11-,14-,15+/m0/s1 |
| InChIKey | CDIONMUWHFYLPO-TUKIKUTGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galanthan (CHEBI:35646) is a indolizidine alkaloid (CHEBI:38511) |
| galanthan (CHEBI:35646) is a indolizine alkaloid fundamental parent (CHEBI:38513) |
| Incoming Relation(s) |
| caranine (CHEBI:3383) has parent hydride galanthan (CHEBI:35646) |
| lycorine (CHEBI:6601) has parent hydride galanthan (CHEBI:35646) |
| IUPAC Name |
|---|
| galanthan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8326915 | Beilstein |