EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | [H][C@@]12C3=CC[C@@H](O)[C@@]1([H])c1cc4c(cc1CN2CC3)OCO4 |
| InChI | InChI=1S/C16H17NO3/c18-12-2-1-9-3-4-17-7-10-5-13-14(20-8-19-13)6-11(10)15(12)16(9)17/h1,5-6,12,15-16,18H,2-4,7-8H2/t12-,15-,16-/m1/s1 |
| InChIKey | XKYSLILSDJBMCU-DAXOMENPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crinum bulbispermum (ncbitaxon:209086) | bulb (BTO:0000159) | PubMed (15587597) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caranine (CHEBI:3383) has parent hydride galanthan (CHEBI:35646) |
| caranine (CHEBI:3383) has role plant metabolite (CHEBI:76924) |
| caranine (CHEBI:3383) is a indolizidine alkaloid (CHEBI:38511) |
| caranine (CHEBI:3383) is a organic heteropentacyclic compound (CHEBI:38164) |
| caranine (CHEBI:3383) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| acetylcaranine (CHEBI:2415) has functional parent caranine (CHEBI:3383) |
| IUPAC Names |
|---|
| (1R,12bS,12cS)-1,2,4,5,12b,12c-hexahydro-7H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridin-1-ol |
| 9,10-methylenedioxygalanth-3(12)-en-1α-ol |
| Synonyms | Source |
|---|---|
| 2-deoxylycorine | ChEBI |
| Caranine | KEGG COMPOUND |
| Citations |
|---|