EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N |
| Net Charge | 0 |
| Average Mass | 235.330 |
| Monoisotopic Mass | 235.13610 |
| SMILES | c1ccc2c(c1)CC1c3ccccc3CCN1C2 |
| InChI | InChI=1S/C17H17N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-8,17H,9-12H2 |
| InChIKey | BRLDZKPJJNASGG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| berbine (CHEBI:35611) is a berberine alkaloid (CHEBI:22754) |
| berbine (CHEBI:35611) is a isoquinoline alkaloid fundamental parent (CHEBI:38515) |
| berbine (CHEBI:35611) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) has functional parent berbine (CHEBI:35611) |
| α-berbine (CHEBI:50400) is a berbine (CHEBI:35611) |
| β-berbine (CHEBI:35614) is a berbine (CHEBI:35611) |
| IUPAC Name |
|---|
| berbine |
| Synonym | Source |
|---|---|
| 5,8,13,13a-tetrahydro-6H-dibenzo[a,g]quinolizine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:86068 | Beilstein |
| CAS:483-49-8 | ChemIDplus |