EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17NO4 |
| Net Charge | 0 |
| Average Mass | 299.326 |
| Monoisotopic Mass | 299.11576 |
| SMILES | Oc1cc2c(cc1O)C1Cc3ccc(O)c(O)c3CN1CC2 |
| InChI | InChI=1S/C17H17NO4/c19-14-2-1-9-5-13-11-7-16(21)15(20)6-10(11)3-4-18(13)8-12(9)17(14)22/h1-2,6-7,13,19-22H,3-5,8H2 |
| InChIKey | TVKAUFJQMRSZFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) has functional parent berbine (CHEBI:35611) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) has role metabolite (CHEBI:25212) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) is a berberine alkaloid (CHEBI:22754) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) is a organic heterotetracyclic compound (CHEBI:38163) |
| 2,3,9,10-tetrahydroxyberbine (CHEBI:31071) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5,8,13,13a-tetrahydro-6H-isoquinolino[3,2-a]isoquinoline-2,3,9,10-tetrol |
| Manual Xrefs | Databases |
|---|---|
| C12330 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:43264 | Reaxys |