EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N |
| Net Charge | 0 |
| Average Mass | 235.330 |
| Monoisotopic Mass | 235.13610 |
| SMILES | [H][C@@]12Cc3ccccc3CN1CCc1ccccc12 |
| InChI | InChI=1S/C17H17N/c1-2-7-15-12-18-10-9-13-5-3-4-8-16(13)17(18)11-14(15)6-1/h1-8,17H,9-12H2/t17-/m0/s1 |
| InChIKey | BRLDZKPJJNASGG-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-berbine (CHEBI:50400) is a berbine (CHEBI:35611) |
| α-berbine (CHEBI:50400) is enantiomer of β-berbine (CHEBI:35614) |
| Incoming Relation(s) |
| N-methyl-α-berbine (CHEBI:50538) has functional parent α-berbine (CHEBI:50400) |
| β-berbine (CHEBI:35614) is enantiomer of α-berbine (CHEBI:50400) |
| IUPAC Name |
|---|
| 13aα-berbine |
| Synonyms | Source |
|---|---|
| berbine | ChemIDplus |
| (S)-5,8,13,13a-tetrahydro-6H-dibenzo[a,g]quinolizine | ChEBI |
| (S)-7,8,13,14-Tetrahydroprotoberberine | KEGG COMPOUND |
| (S)-Tetrahydroprotoberberine | KEGG COMPOUND |