EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34FNO5 |
| Net Charge | 0 |
| Average Mass | 459.558 |
| Monoisotopic Mass | 459.24210 |
| SMILES | COCc1c(C(C)C)nc(C(C)C)c(/C=C/[C@@H](O)C[C@@H](O)CC(=O)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34FNO5/c1-15(2)25-21(11-10-19(29)12-20(30)13-23(31)32)24(17-6-8-18(27)9-7-17)22(14-33-5)26(28-25)16(3)4/h6-11,15-16,19-20,29-30H,12-14H2,1-5H3,(H,31,32)/b11-10+/t19-,20-/m1/s1 |
| InChIKey | SEERZIQQUAZTOL-ANMDKAQQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerivastatin (CHEBI:3558) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| cerivastatin (CHEBI:3558) is a pyridines (CHEBI:26421) |
| cerivastatin (CHEBI:3558) is a statin (synthetic) (CHEBI:87635) |
| cerivastatin (CHEBI:3558) is conjugate acid of cerivastatin(1−) (CHEBI:406059) |
| Incoming Relation(s) |
| cerivastatin(1−) (CHEBI:406059) is conjugate base of cerivastatin (CHEBI:3558) |
| IUPAC Name |
|---|
| (3R,5S,6E)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
| INN | Source |
|---|---|
| cerivastatin | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cerivastatin | KEGG COMPOUND |
| (3R,5S,E)-7-(4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl)-3,5-dihydroxyhept-6-enoic acid | ChEMBL |
| (3R,5S,6E)-7-(4-(p-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)-3-pyridyl)-3,5-dihydroxy-6-heptenoic acid | ChemIDplus |
| (3R,5S,6E)-7-(4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-bis(1-methylethyl)-3-pyridinyl)-3,5-dihydroxy-6-heptenoic acid | ChemIDplus |
| cerivastatin acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07966 | KEGG COMPOUND |
| D07661 | KEGG DRUG |
| DB00439 | DrugBank |
| Cerivastatin | Wikipedia |
| 577 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8366578 | Beilstein |
| CAS:145599-86-6 | KEGG COMPOUND |
| CAS:145599-86-6 | ChemIDplus |
| Citations |
|---|