EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:355510 - cefotiam
| Formula | C18H23N9O4S3 |
| Net Charge | 0 |
| Average Mass | 525.642 |
| Monoisotopic Mass | 525.10351 |
| SMILES | [H][C@]12SCC(CSc3nnnn3CCN(C)C)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C18H23N9O4S3/c1-25(2)3-4-26-18(22-23-24-26)34-7-9-6-32-15-12(14(29)27(15)13(9)16(30)31)21-11(28)5-10-8-33-17(19)20-10/h8,12,15H,3-7H2,1-2H3,(H2,19,20)(H,21,28)(H,30,31)/t12-,15-/m1/s1 |
| InChIKey | QYQDKDWGWDOFFU-IUODEOHRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotiam (CHEBI:355510) has role antibacterial drug (CHEBI:36047) |
| cefotiam (CHEBI:355510) is a cephalosporin (CHEBI:23066) |
| cefotiam (CHEBI:355510) is a semisynthetic derivative (CHEBI:72588) |
| cefotiam (CHEBI:355510) is a β-lactam antibiotic allergen (CHEBI:88225) |
| Incoming Relation(s) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) has functional parent cefotiam (CHEBI:355510) |
| cefotiam hexetil ester (CHEBI:59211) has functional parent cefotiam (CHEBI:355510) |
| cefotiam dihydrochloride (CHEBI:31374) has part cefotiam (CHEBI:355510) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2-amino-1,3-thiazol-4-yl)acetyl]amino}-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-(2-amino-1,3-thiazol-4-yl)acetamido-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefotiam | ChemIDplus |
| cefotiamum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-[2-(2-Amino-thiazol-4-yl)-acetylamino]-3-[1-(2-dimethylamino-ethyl)-1H-tetrazol-5-ylsulfanylmethyl]-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ChEMBL |
| CEFOTIAM | ChEMBL |
| CTM | ChEBI |
| Citations |
|---|