EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N9O4S3.2HCl |
| Net Charge | 0 |
| Average Mass | 598.564 |
| Monoisotopic Mass | 597.05687 |
| SMILES | Cl.Cl.[H][C@]12SCC(CSc3nnnn3CCN(C)C)=C(C(=O)O)N1C(=O)[C@@]2([H])NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C18H23N9O4S3.2ClH/c1-25(2)3-4-26-18(22-23-24-26)34-7-9-6-32-15-12(14(29)27(15)13(9)16(30)31)21-11(28)5-10-8-33-17(19)20-10;;/h8,12,15H,3-7H2,1-2H3,(H2,19,20)(H,21,28)(H,30,31);2*1H/t12-,15-;;/m1../s1 |
| InChIKey | BWRRTAXZCKVRON-DGPOFWGLSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotiam dihydrochloride (CHEBI:31374) has part cefotiam (CHEBI:355510) |
| cefotiam dihydrochloride (CHEBI:31374) has role antibacterial drug (CHEBI:36047) |
| cefotiam dihydrochloride (CHEBI:31374) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2-amino-1,3-thiazol-4-yl)acetyl]amino}-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid dihydrochloride |
| 7β-(2-amino-1,3-thiazol-4-yl)acetamido-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-3,4-didehydrocepham-4-carboxylic acid dihydrochloride |
| Synonyms | Source |
|---|---|
| 7(R)-(2-(2-amino-4-thiazolyl)acetamido)-3-(((1-(2-(dimethylamino)ethyl)-1H-tetrazol-5-yl)thio)methyl)-3-cephem-4-carboxylic acid dihydrochloride | ChemIDplus |
| cefotiam hydrochloride | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:66309-69-1 | ChemIDplus |