EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N9O7S3.2HCl |
| Net Charge | 0 |
| Average Mass | 768.772 |
| Monoisotopic Mass | 767.15116 |
| SMILES | Cl.Cl.[H][C@]12SCC(CSc3nnnn3CCN(C)C)=C(C(=O)OC(C)OC(=O)OC3CCCCC3)N1C(=O)[C@@]2([H])NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C27H37N9O7S3.2ClH/c1-15(42-27(40)43-18-7-5-4-6-8-18)41-24(39)21-16(13-46-26-31-32-33-35(26)10-9-34(2)3)12-44-23-20(22(38)36(21)23)30-19(37)11-17-14-45-25(28)29-17;;/h14-15,18,20,23H,4-13H2,1-3H3,(H2,28,29)(H,30,37);2*1H/t15?,20-,23-;;/m1../s1 |
| InChIKey | FFSANQNELHESQJ-LWBICVDYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) has functional parent cefotiam (CHEBI:355510) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) has part cefotiam hexetil ester (CHEBI:59211) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) has role antibacterial drug (CHEBI:36047) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) has role prodrug (CHEBI:50266) |
| cefotiam hexetil dihydrochloride (CHEBI:31373) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 1-{[(cyclohexyloxy)carbonyl]oxy}ethyl (6R,7R)-7-{[(2-amino-1,3-thiazol-4-yl)acetyl]amino}-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate dihydrochloride |
| 1-{[(cyclohexyloxy)carbonyl]oxy}ethyl 7β-(2-amino-1,3-thiazol-4-yl)acetamido-3-[({1-[2-(dimethylamino)ethyl]-1H-tetrazol-5-yl}sulfanyl)methyl]-3,4-didehydrocepham-4-carboxylate dihydrochloride |
| Synonyms | Source |
|---|---|
| cefotiam 1-(cyclohexyloxycarbonyloxy)ethyl ester dihydrochloride | ChEBI |
| cefotiam hexetil HCl | ChemIDplus |
| cefotiam hexetil hydrochloride | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01415 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:95789-30-3 | ChemIDplus |
| CAS:95789-30-3 | KEGG DRUG |