EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O4S |
| Net Charge | 0 |
| Average Mass | 347.396 |
| Monoisotopic Mass | 347.09398 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| InChIKey | ZAIPMKNFIOOWCQ-UEKVPHQBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalexin (CHEBI:3534) has role antibacterial drug (CHEBI:36047) |
| cephalexin (CHEBI:3534) is a cephalosporin (CHEBI:23066) |
| cephalexin (CHEBI:3534) is a semisynthetic derivative (CHEBI:72588) |
| cephalexin (CHEBI:3534) is a β-lactam antibiotic allergen (CHEBI:88225) |
| cephalexin (CHEBI:3534) is conjugate acid of cephalexin(1−) (CHEBI:59392) |
| Incoming Relation(s) |
| cefalexin pivoxil (CHEBI:135750) has functional parent cephalexin (CHEBI:3534) |
| cephalexin monohydrate (CHEBI:3535) has part cephalexin (CHEBI:3534) |
| cephalexin(1−) (CHEBI:59392) is conjugate base of cephalexin (CHEBI:3534) |
| IUPAC Name |
|---|
| 7β-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefalexina | ChemIDplus |
| cefalexine | ChemIDplus |
| cefalexinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cefalexin | KEGG COMPOUND |
| (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Cephacillin | ChemIDplus |
| Cepexin | ChemIDplus |
| Celexin | ChemIDplus |
| Cepastar | ChemIDplus |
| Citations |
|---|