EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N3O6S |
| Net Charge | 0 |
| Average Mass | 461.540 |
| Monoisotopic Mass | 461.16206 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O6S/c1-12-10-32-19-15(24-17(26)14(23)13-8-6-5-7-9-13)18(27)25(19)16(12)20(28)30-11-31-21(29)22(2,3)4/h5-9,14-15,19H,10-11,23H2,1-4H3,(H,24,26)/t14-,15-,19-/m1/s1 |
| InChIKey | DIGADQKVPFDJSI-SPYBWZPUSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefalexin pivoxil (CHEBI:135750) has functional parent cephalexin (CHEBI:3534) |
| cefalexin pivoxil (CHEBI:135750) is a cephams (CHEBI:35995) |
| cefalexin pivoxil (CHEBI:135750) is a pivaloyloxymethyl ester (CHEBI:136685) |
| Synonyms | Source |
|---|---|
| pivalexin | DrugCentral |
| pivcephalexin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2217 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:27726-31-4 | DrugCentral |