EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O4S.H2O |
| Net Charge | 0 |
| Average Mass | 365.411 |
| Monoisotopic Mass | 365.10454 |
| SMILES | O.[H][C@]12SCC(C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O4S.H2O/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9;/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23);1H2/t10-,11-,15-;/m1./s1 |
| InChIKey | AVGYWQBCYZHHPN-CYJZLJNKSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalexin monohydrate (CHEBI:3535) has part cephalexin (CHEBI:3534) |
| cephalexin monohydrate (CHEBI:3535) has role antibacterial drug (CHEBI:36047) |
| cephalexin monohydrate (CHEBI:3535) is a hydrate (CHEBI:35505) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid—water (1/1) |
| 7β-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid—water (1/1) |
| Synonyms | Source |
|---|---|
| 7-(D-α-amino-α-phenylacetamido)-3-methyl-3-cephem-4-carboxylic acid monohydrate | ChemIDplus |
| cefalexin·H2O | ChEBI |
| cefalexin hydrate | ChEBI |
| cefalexin monohydrate | ChEBI |
| Cephalexin | KEGG COMPOUND |
| cephalexin·H2O | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8175806 | Beilstein |
| CAS:23325-78-2 | KEGG COMPOUND |
| CAS:23325-78-2 | ChemIDplus |