EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O4 |
| Net Charge | 0 |
| Average Mass | 240.214 |
| Monoisotopic Mass | 240.04226 |
| SMILES | O=C1c2ccc(O)cc2C(=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthraflavic acid (CHEBI:34250) has parent hydride anthracene (CHEBI:35298) |
| anthraflavic acid (CHEBI:34250) has role antimutagen (CHEBI:73190) |
| anthraflavic acid (CHEBI:34250) has role plant metabolite (CHEBI:76924) |
| anthraflavic acid (CHEBI:34250) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 2,6-dihydroxyanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 2,6-dihydroxy-9,10-anthracenedione | ChemIDplus |
| 2,6-dihydroxy-9,10-anthraquinone | IUPAC |
| 2,6-dihydroxyanthra-9,10-quinone | NIST Chemistry WebBook |
| 2,6-Dihydroxyanthraquinone | KEGG COMPOUND |
| anthraflavic acid | NIST Chemistry WebBook |
| anthraflavin | ChemIDplus |
| Citations |
|---|