EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6-/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-WAXACMCWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-glucuronic acid (CHEBI:42717) is a D-glucopyranuronic acid (CHEBI:47952) |
| α-D-glucuronic acid (CHEBI:42717) is conjugate acid of α-D-glucuronate (CHEBI:189642) |
| Incoming Relation(s) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) has functional parent α-D-glucuronic acid (CHEBI:42717) |
| methyl α-D-glucopyranuronate (CHEBI:153547) has functional parent α-D-glucuronic acid (CHEBI:42717) |
| UDP-α-D-glucuronic acid (CHEBI:17200) has functional parent α-D-glucuronic acid (CHEBI:42717) |
| α-D-glucuronate (CHEBI:189642) is conjugate base of α-D-glucuronic acid (CHEBI:42717) |
| IUPAC Names |
|---|
| (2S,3S,4S,5R,6S)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylic acid |
| α-D-glucopyranuronic acid |
| Synonyms | Source |
|---|---|
| D-GLUCURONIC ACID | PDBeChem |
| GlcAa | ChEBI |
| GlcAα | ChEBI |
| α-D-glucopyranuronic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB03156 | DrugBank |
| GCU | PDBeChem |
| HMDB0000127 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1285548 | Reaxys |
| Gmelin:397419 | Gmelin |
| Citations |
|---|