EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O7 |
| Net Charge | -1 |
| Average Mass | 193.131 |
| Monoisotopic Mass | 193.03538 |
| SMILES | O=C([O-])[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3+,4-,6-/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-WAXACMCWSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-glucuronate (CHEBI:189642) is a D-glucopyranuronate (CHEBI:58720) |
| α-D-glucuronate (CHEBI:189642) is conjugate base of α-D-glucuronic acid (CHEBI:42717) |
| Incoming Relation(s) |
| α-D-glucuronic acid (CHEBI:42717) is conjugate acid of α-D-glucuronate (CHEBI:189642) |
| UniProt Name | Source |
|---|---|
| α-D-glucuronate | UniProt |