EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O18P2 |
| Net Charge | 0 |
| Average Mass | 580.285 |
| Monoisotopic Mass | 580.03429 |
| SMILES | O=C(O)[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1 |
| InChIKey | HDYANYHVCAPMJV-LXQIFKJMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (11420884) | ||
| - | MetaboLights (MTBLS264) | ||
| - | MetaboLights (MTBLS156) | ||
| - | MetaboLights (MTBLS267) | ||
| - | MetaboLights (MTBLS265) | ||
| - | MetaboLights (MTBLS127) | ||
| - | MetaboLights (MTBLS266) | ||
| - | MetaboLights (MTBLS263) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-α-D-glucuronic acid (CHEBI:17200) has functional parent α-D-glucuronic acid (CHEBI:42717) |
| UDP-α-D-glucuronic acid (CHEBI:17200) has role Escherichia coli metabolite (CHEBI:76971) |
| UDP-α-D-glucuronic acid (CHEBI:17200) has role human metabolite (CHEBI:77746) |
| UDP-α-D-glucuronic acid (CHEBI:17200) has role mouse metabolite (CHEBI:75771) |
| UDP-α-D-glucuronic acid (CHEBI:17200) is a UDP-D-glucuronic acid (CHEBI:197331) |
| UDP-α-D-glucuronic acid (CHEBI:17200) is conjugate acid of UDP-α-D-glucuronate(3−) (CHEBI:58052) |
| Incoming Relation(s) |
| UDP-2,3-diacetamido-2,3-dideoxy-α-D-glucuronic acid (CHEBI:48402) has functional parent UDP-α-D-glucuronic acid (CHEBI:17200) |
| UDP-α-D-glucuronate(3−) (CHEBI:58052) is conjugate base of UDP-α-D-glucuronic acid (CHEBI:17200) |
| IUPAC Name |
|---|
| uridine 5'-[3-(α-D-glucopyranuronosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| UDP-alpha-D-glucuronate | KEGG COMPOUND |
| UDP-D-glucuronate | KEGG COMPOUND |
| UDPglucuronate | KEGG COMPOUND |
| UDPglucuronate | KEGG COMPOUND |
| URIDINE-5'-DIPHOSPHATE-GLUCURONIC ACID | PDBeChem |
| uridine diphosphate glucuronic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00007238 | KNApSAcK |
| C00167 | KEGG COMPOUND |
| G10612 | KEGG GLYCAN |
| HMDB0000935 | HMDB |
| UGA | PDBeChem |
| Uridine_diphosphate_glucuronic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78881 | Reaxys |
| CAS:2616-64-0 | ChemIDplus |
| Citations |
|---|