EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | C=CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13) |
| InChIKey | FRPZMMHWLSIFAZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-undecenoic acid (CHEBI:35045) has role antifungal drug (CHEBI:86327) |
| 10-undecenoic acid (CHEBI:35045) has role plant metabolite (CHEBI:76924) |
| 10-undecenoic acid (CHEBI:35045) is a undecenoic acid (CHEBI:39448) |
| 10-undecenoic acid (CHEBI:35045) is conjugate acid of 10-undecenoate (CHEBI:83041) |
| Incoming Relation(s) |
| methyl undecenate (CHEBI:87493) has functional parent 10-undecenoic acid (CHEBI:35045) |
| 10-undecenoate (CHEBI:83041) is conjugate base of 10-undecenoic acid (CHEBI:35045) |
| IUPAC Name |
|---|
| undec-10-enoic acid |
| Synonyms | Source |
|---|---|
| 10-hendecenoic acid | ChemIDplus |
| 10-undecenoic acid | NIST Chemistry WebBook |
| 10-Undecensäure | ChEBI |
| 10-undecylenic acid | NIST Chemistry WebBook |
| acide 10-undécanoïque | IUPAC |
| acide 10-undécylique | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3446 | DrugCentral |
| C13910 | KEGG COMPOUND |
| D02159 | KEGG DRUG |
| HMDB0033724 | HMDB |
| LMFA01030036 | LIPID MAPS |
| Undecylenic_acid | Wikipedia |
| Citations |
|---|