EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19O2 |
| Net Charge | -1 |
| Average Mass | 183.271 |
| Monoisotopic Mass | 183.13905 |
| SMILES | C=CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13)/p-1 |
| InChIKey | FRPZMMHWLSIFAZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-undecenoate (CHEBI:83041) has role plant metabolite (CHEBI:76924) |
| 10-undecenoate (CHEBI:83041) is a undecenoate (CHEBI:83042) |
| 10-undecenoate (CHEBI:83041) is conjugate base of 10-undecenoic acid (CHEBI:35045) |
| Incoming Relation(s) |
| 10-undecenoic acid (CHEBI:35045) is conjugate acid of 10-undecenoate (CHEBI:83041) |
| IUPAC Name |
|---|
| undec-10-enoate |
| Synonym | Source |
|---|---|
| (11:1n1) | ChEBI |