EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87493 - methyl undecenate
| Formula | C12H22O2 |
| Net Charge | 0 |
| Average Mass | 198.306 |
| Monoisotopic Mass | 198.16198 |
| SMILES | C=CCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3H,1,4-11H2,2H3 |
| InChIKey | KISVAASFGZJBCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl undecenate (CHEBI:87493) has functional parent 10-undecenoic acid (CHEBI:35045) |
| methyl undecenate (CHEBI:87493) has role metabolite (CHEBI:25212) |
| methyl undecenate (CHEBI:87493) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl undec-10-enoate |
| Synonyms | Source |
|---|---|
| 10-undecylenic acid methyl ester | ChEBI |
| methyl 10-undecanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029585 | HMDB |
| Citations |
|---|