EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O4 |
| Net Charge | 0 |
| Average Mass | 299.291 |
| Monoisotopic Mass | 299.13420 |
| SMILES | [H][C@@]12NC(=N)N[C@]13N(CCC3(O)O)C(=N)N[C@H]2COC(N)=O |
| InChI | InChI=1S/C10H17N7O4/c11-6-15-5-4(3-21-8(13)18)14-7(12)17-2-1-9(19,20)10(5,17)16-6/h4-5,19-20H,1-3H2,(H2,12,14)(H2,13,18)(H3,11,15,16)/t4-,5-,10-/m0/s1 |
| InChIKey | RPQXVSUAYFXFJA-HGRQIUPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. neurotoxin A poison that interferes with the functions of the nervous system. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. sodium channel blocker An agent that inhibits sodium influx through cell membranes. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. sodium channel blocker An agent that inhibits sodium influx through cell membranes. neurotoxin A poison that interferes with the functions of the nervous system. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saxitoxin (CHEBI:34970) has role cyanotoxin (CHEBI:88048) |
| saxitoxin (CHEBI:34970) has role marine metabolite (CHEBI:76507) |
| saxitoxin (CHEBI:34970) has role neurotoxin (CHEBI:50910) |
| saxitoxin (CHEBI:34970) has role sodium channel blocker (CHEBI:38633) |
| saxitoxin (CHEBI:34970) has role toxin (CHEBI:27026) |
| saxitoxin (CHEBI:34970) is a alkaloid (CHEBI:22315) |
| saxitoxin (CHEBI:34970) is a carbamate ester (CHEBI:23003) |
| saxitoxin (CHEBI:34970) is a guanidines (CHEBI:24436) |
| saxitoxin (CHEBI:34970) is a ketone hydrate (CHEBI:63734) |
| saxitoxin (CHEBI:34970) is a paralytic shellfish toxin (CHEBI:167564) |
| saxitoxin (CHEBI:34970) is a pyrrolopurine (CHEBI:136861) |
| saxitoxin (CHEBI:34970) is conjugate base of saxitoxin(2+) (CHEBI:180458) |
| Incoming Relation(s) |
| neosaxitoxin (CHEBI:167561) has functional parent saxitoxin (CHEBI:34970) |
| saxitoxin acetate (CHEBI:142400) has part saxitoxin (CHEBI:34970) |
| saxitoxin(2+) (CHEBI:180458) is conjugate acid of saxitoxin (CHEBI:34970) |
| IUPAC Name |
|---|
| [(3aS,4R,10aS)-10,10-dihydroxy-2,6-diiminooctahydro-1H,8H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:47858 | Reaxys |
| CAS:35523-89-8 | KEGG COMPOUND |
| CAS:35523-89-8 | ChemIDplus |
| Citations |
|---|