EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N7O4 |
| Net Charge | +2 |
| Average Mass | 301.307 |
| Monoisotopic Mass | 301.14875 |
| SMILES | [H][C@@]12NC(=[NH2+])N[C@]13N(CCC3(O)O)C(=[NH2+])N[C@H]2COC(N)=O |
| InChI | InChI=1S/C10H17N7O4/c11-6-15-5-4(3-21-8(13)18)14-7(12)17-2-1-9(19,20)10(5,17)16-6/h4-5,19-20H,1-3H2,(H2,12,14)(H2,13,18)(H3,11,15,16)/p+2/t4-,5-,10-/m0/s1 |
| InChIKey | RPQXVSUAYFXFJA-HGRQIUPRSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saxitoxin(2+) (CHEBI:180458) is a iminium ion (CHEBI:35286) |
| saxitoxin(2+) (CHEBI:180458) is conjugate acid of saxitoxin (CHEBI:34970) |
| Incoming Relation(s) |
| saxitoxin (CHEBI:34970) is conjugate base of saxitoxin(2+) (CHEBI:180458) |
| IUPAC Name |
|---|
| (3aS,4R,10aS)-4-[(carbamoyloxy)methyl]-10,10-dihydroxyhexahydro-1H,8H-pyrrolo[1,2-c]purine-2,6-bis(iminium) |
| Synonym | Source |
|---|---|
| saxitoxin dication | ChEBI |
| UniProt Name | Source |
|---|---|
| saxitoxin | UniProt |