EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | [H][C@]12CCCC=C1C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C18H26O3/c1-12-6-7-13-4-2-3-5-17(13)16(12)9-8-15-10-14(19)11-18(20)21-15/h4,6-7,12,14-17,19H,2-3,5,8-11H2,1H3/t12-,14+,15+,16-,17-/m0/s1 |
| InChIKey | NXIASLUNMKAUTN-WFKFIOEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | cell suspension culture (BTO:0000221) | PubMed (1010803) | Strain: SANK 18767 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML-236C (CHEBI:34828) has role antiatherosclerotic agent (CHEBI:145947) |
| ML-236C (CHEBI:34828) has role anticholesteremic drug (CHEBI:35821) |
| ML-236C (CHEBI:34828) has role antilipemic drug (CHEBI:35679) |
| ML-236C (CHEBI:34828) has role antimicrobial agent (CHEBI:33281) |
| ML-236C (CHEBI:34828) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| ML-236C (CHEBI:34828) has role fungal metabolite (CHEBI:76946) |
| ML-236C (CHEBI:34828) is a 2-pyranones (CHEBI:75885) |
| ML-236C (CHEBI:34828) is a carbobicyclic compound (CHEBI:36785) |
| ML-236C (CHEBI:34828) is a hexahydronaphthalenes (CHEBI:142348) |
| ML-236C (CHEBI:34828) is a polyketide (CHEBI:26188) |
| ML-236C (CHEBI:34828) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| compactin diol lactone (CHEBI:34652) has functional parent ML-236C (CHEBI:34828) |
| IUPAC Name |
|---|
| (4R,6R)-4-hydroxy-6-{2-[(1S,2S,8aR)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| (4R,6R)-4-hydroxy-6-{2-[(1S,2S,8aR)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}oxan-2-one | IUPAC |
| Antibiotic ML 236C | ChEBI |
| ML 236C | KNApSAcK |
| ML-236C | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1588586 | Reaxys |
| CAS:58889-18-2 | KEGG COMPOUND |
| CAS:58889-18-2 | ChemIDplus |
| Citations |
|---|