EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | [H][C@@]12C(=CCC[C@@H]1O)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C18H26O4/c1-11-5-6-12-3-2-4-16(20)18(12)15(11)8-7-14-9-13(19)10-17(21)22-14/h3,5-6,11,13-16,18-20H,2,4,7-10H2,1H3/t11-,13+,14+,15-,16-,18-/m0/s1 |
| InChIKey | WWSNTLOVYSRDEL-DZSDEGEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | cell suspension culture (BTO:0000221) | PubMed (1010803) | Strain: SANK 18767 |
| Roles Classification |
|---|
| Biological Roles: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| compactin diol lactone (CHEBI:34652) has functional parent ML-236C (CHEBI:34828) |
| compactin diol lactone (CHEBI:34652) has role antiatherosclerotic agent (CHEBI:145947) |
| compactin diol lactone (CHEBI:34652) has role anticholesteremic drug (CHEBI:35821) |
| compactin diol lactone (CHEBI:34652) has role antilipemic drug (CHEBI:35679) |
| compactin diol lactone (CHEBI:34652) has role antimicrobial agent (CHEBI:33281) |
| compactin diol lactone (CHEBI:34652) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| compactin diol lactone (CHEBI:34652) has role fungal metabolite (CHEBI:76946) |
| compactin diol lactone (CHEBI:34652) is a 2-pyranones (CHEBI:75885) |
| compactin diol lactone (CHEBI:34652) is a carbobicyclic compound (CHEBI:36785) |
| compactin diol lactone (CHEBI:34652) is a hexahydronaphthalenes (CHEBI:142348) |
| compactin diol lactone (CHEBI:34652) is a polyketide (CHEBI:26188) |
| compactin diol lactone (CHEBI:34652) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R,6R)-4-hydroxy-6-{2-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}tetrahydro-2H-pyran-2-one |
| Synonyms | Source |
|---|---|
| (4R,6R)-4-hydroxy-6-{2-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}oxan-2-one | IUPAC |
| Antibiotic ML 236A | ChEBI |
| compactin diol lactone | KEGG COMPOUND |
| desmethylmonacolin J | ChEBI |
| ML 236A | ChemIDplus |
| ML-236A | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| compactin diol lactone | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:58889-19-3 | ChemIDplus |
| CAS:58889-19-3 | KEGG COMPOUND |
| Citations |
|---|