EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O |
| InChI | InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| InChIKey | DXYUAIFZCFRPTH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycitein (CHEBI:34778) has functional parent isoflavone (CHEBI:18220) |
| glycitein (CHEBI:34778) has role fungal metabolite (CHEBI:76946) |
| glycitein (CHEBI:34778) has role phytoestrogen (CHEBI:76989) |
| glycitein (CHEBI:34778) has role plant metabolite (CHEBI:76924) |
| glycitein (CHEBI:34778) is a 7-hydroxyisoflavone (CHEBI:12256) |
| glycitein (CHEBI:34778) is a methoxyisoflavone (CHEBI:38756) |
| Incoming Relation(s) |
| glycitein 4'-O-glucuronide (CHEBI:133667) has functional parent glycitein (CHEBI:34778) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4H-one |
| Synonyms | Source |
|---|---|
| 7,4'-Dihydroxy-6-methoxyisoflavone | KEGG COMPOUND |
| 7-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00009392 | KNApSAcK |
| C14536 | KEGG COMPOUND |
| CPD-7027 | MetaCyc |
| Glycitein | Wikipedia |
| HMDB0005781 | HMDB |
| LMPK12050104 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1351032 | Reaxys |
| CAS:40957-83-3 | ChemIDplus |
| CAS:40957-83-3 | KEGG COMPOUND |
| Citations |
|---|