EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O3 |
| Net Charge | 0 |
| Average Mass | 238.242 |
| Monoisotopic Mass | 238.06299 |
| SMILES | O=c1c(-c2ccccc2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O3/c16-11-6-7-12-14(8-11)18-9-13(15(12)17)10-4-2-1-3-5-10/h1-9,16H |
| InChIKey | WMKOZARWBMFKAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxyisoflavone (CHEBI:12256) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| 7-hydroxyisoflavone (CHEBI:12256) has role metabolite (CHEBI:25212) |
| 7-hydroxyisoflavone (CHEBI:12256) is a 7-hydroxyisoflavones (CHEBI:55465) |
| 7-hydroxyisoflavone (CHEBI:12256) is conjugate acid of 7-hydroxyisoflavone(1−) (CHEBI:77616) |
| Incoming Relation(s) |
| 7-hydroxyisoflavone 7-O-β-D-glucoside (CHEBI:18174) has functional parent 7-hydroxyisoflavone (CHEBI:12256) |
| glycitein (CHEBI:34778) is a 7-hydroxyisoflavone (CHEBI:12256) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a 7-hydroxyisoflavone (CHEBI:12256) |
| 7-hydroxyisoflavone(1−) (CHEBI:77616) is conjugate base of 7-hydroxyisoflavone (CHEBI:12256) |
| IUPAC Name |
|---|
| 7-hydroxy-3-phenyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 4H-1-Benzopyran-4-one, 7-hydroxy-3-phenyl- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:193534 | Reaxys |
| CAS:13057-72-2 | ChemIDplus |
| Citations |
|---|