EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O11 |
| Net Charge | 0 |
| Average Mass | 460.391 |
| Monoisotopic Mass | 460.10056 |
| SMILES | COc1cc2c(=O)c(-c3ccc(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)cc3)coc2cc1O |
| InChI | InChI=1S/C22H20O11/c1-30-15-6-11-14(7-13(15)23)31-8-12(16(11)24)9-2-4-10(5-3-9)32-22-19(27)17(25)18(26)20(33-22)21(28)29/h2-8,17-20,22-23,25-27H,1H3,(H,28,29)/t17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | FXGSRMKCZRQRER-SXFAUFNYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycitein 4'-O-glucuronide (CHEBI:133667) has functional parent glycitein (CHEBI:34778) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a 7-hydroxyisoflavone (CHEBI:12256) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a glycosyloxyisoflavone (CHEBI:74630) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a methoxyisoflavone (CHEBI:38756) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a monosaccharide derivative (CHEBI:63367) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is a β-D-glucosiduronic acid (CHEBI:15341) |
| glycitein 4'-O-glucuronide (CHEBI:133667) is conjugate acid of glycitein 4'-O-glucuronide(1−) (CHEBI:747564) |
| Incoming Relation(s) |
| glycitein 4'-O-glucuronide(1−) (CHEBI:747564) is conjugate base of glycitein 4'-O-glucuronide (CHEBI:133667) |
| IUPAC Name |
|---|
| 4-(7-hydroxy-6-methoxy-4-oxo-4H-1-benzopyran-3-yl)phenyl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| glycitein 4'-O-β-glucuronide | ChEBI |
| glycitein 4'-O-β-D-glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041740 | HMDB |