EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O2 |
| Net Charge | 0 |
| Average Mass | 110.112 |
| Monoisotopic Mass | 110.03678 |
| SMILES | Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| InChIKey | YCIMNLLNPGFGHC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catechol (CHEBI:18135) has role allelochemical (CHEBI:62215) |
| catechol (CHEBI:18135) has role genotoxin (CHEBI:50902) |
| catechol (CHEBI:18135) has role plant metabolite (CHEBI:76924) |
| catechol (CHEBI:18135) is a catechols (CHEBI:33566) |
| catechol (CHEBI:18135) is conjugate acid of catecholate(1−) (CHEBI:50524) |
| Incoming Relation(s) |
| 2-ethoxyphenol (CHEBI:141701) has functional parent catechol (CHEBI:18135) |
| 2-isopropoxy-4-propenylphenol (CHEBI:59086) has functional parent catechol (CHEBI:18135) |
| 4-allyl-2-isopropoxyphenol (CHEBI:59075) has functional parent catechol (CHEBI:18135) |
| 4-vinylguaiacol sulfate (CHEBI:133544) has functional parent catechol (CHEBI:18135) |
| catechol β-D-glucuronide (CHEBI:133689) has functional parent catechol (CHEBI:18135) |
| guaiacol (CHEBI:28591) has functional parent catechol (CHEBI:18135) |
| guaiacol sulfate (CHEBI:133460) has functional parent catechol (CHEBI:18135) |
| pyrocatechol sulfate (CHEBI:68505) has functional parent catechol (CHEBI:18135) |
| catecholate(1−) (CHEBI:50524) is conjugate base of catechol (CHEBI:18135) |
| IUPAC Name |
|---|
| benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 1,2-Benzenediol | KEGG COMPOUND |
| 1,2-Dihydroxybenzene | KEGG COMPOUND |
| 2-hydroxyphenol | ChEBI |
| Brenzcatechin | KEGG COMPOUND |
| Catechol | KEGG COMPOUND |
| o-hydroxyphenol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| catechol | UniProt |
| Citations |
|---|