EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O2 |
| Net Charge | -1 |
| Average Mass | 109.104 |
| Monoisotopic Mass | 109.02950 |
| SMILES | [O-]c1ccccc1O |
| InChI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H/p-1 |
| InChIKey | YCIMNLLNPGFGHC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catecholate(1−) (CHEBI:50524) has role plant metabolite (CHEBI:76924) |
| catecholate(1−) (CHEBI:50524) is a phenolate anion (CHEBI:50525) |
| catecholate(1−) (CHEBI:50524) is conjugate acid of catecholate(2−) (CHEBI:32402) |
| catecholate(1−) (CHEBI:50524) is conjugate base of catechol (CHEBI:18135) |
| Incoming Relation(s) |
| catechol (CHEBI:18135) is conjugate acid of catecholate(1−) (CHEBI:50524) |
| catecholate(2−) (CHEBI:32402) is conjugate base of catecholate(1−) (CHEBI:50524) |
| IUPAC Name |
|---|
| 2-hydroxyphenolate |
| Synonym | Source |
|---|---|
| pyrocatechol monoanion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:142204 | Gmelin |
| Reaxys:3904355 | Reaxys |