EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | COc1ccccc1O |
| InChI | InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| InChIKey | LHGVFZTZFXWLCP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. EC 1.1.1.25 (shikimate dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of shikimate dehydrogenase (EC 1.1.1.25). |
| Application: | expectorant Compounds that are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. Compare with mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration, and antitussives, which suppress the cough reflex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaiacol (CHEBI:28591) has functional parent catechol (CHEBI:18135) |
| guaiacol (CHEBI:28591) has role disinfectant (CHEBI:48219) |
| guaiacol (CHEBI:28591) has role EC 1.1.1.25 (shikimate dehydrogenase) inhibitor (CHEBI:77484) |
| guaiacol (CHEBI:28591) has role expectorant (CHEBI:77035) |
| guaiacol (CHEBI:28591) has role plant metabolite (CHEBI:76924) |
| guaiacol (CHEBI:28591) is a guaiacols (CHEBI:134251) |
| Incoming Relation(s) |
| 4-hydroxy-3-methoxybenzene-1-sulfonic acid (CHEBI:85537) has functional parent guaiacol (CHEBI:28591) |
| 9,9,9-trimethylisoeugenol (CHEBI:59100) has functional parent guaiacol (CHEBI:28591) |
| eugenol (CHEBI:4917) has functional parent guaiacol (CHEBI:28591) |
| guaiacylglycerol-β-guaiacyl ether (CHEBI:53650) has functional parent guaiacol (CHEBI:28591) |
| isoeugenol (CHEBI:18224) has functional parent guaiacol (CHEBI:28591) |
| IUPAC Name |
|---|
| 2-methoxyphenol |
| Synonyms | Source |
|---|---|
| Guaiacol | KEGG COMPOUND |
| o-Methoxyphenol | KEGG COMPOUND |
| Catechol monomethyl ether | KEGG COMPOUND |
| 1-Hydroxy-2-methoxybenzene | ChemIDplus |
| 2-Hydroxyanisole | ChemIDplus |
| Guaiacol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| guaiacol | UniProt |
| Citations |
|---|