EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O8 |
| Net Charge | 0 |
| Average Mass | 286.236 |
| Monoisotopic Mass | 286.06887 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2ccccc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14O8/c13-5-3-1-2-4-6(5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12-16H,(H,17,18)/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | ICPYZFZFSLTYID-GOVZDWNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (1687010) |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catechol β-D-glucuronide (CHEBI:133689) has functional parent catechol (CHEBI:18135) |
| catechol β-D-glucuronide (CHEBI:133689) has role mouse metabolite (CHEBI:75771) |
| catechol β-D-glucuronide (CHEBI:133689) is a glucosiduronic acid (CHEBI:24302) |
| catechol β-D-glucuronide (CHEBI:133689) is a phenols (CHEBI:33853) |
| catechol β-D-glucuronide (CHEBI:133689) is conjugate acid of catechol β-D-glucuronide(1−) (CHEBI:133691) |
| Incoming Relation(s) |
| catechol β-D-glucuronide(1−) (CHEBI:133691) is conjugate base of catechol β-D-glucuronide (CHEBI:133689) |
| IUPAC Name |
|---|
| 2-hydroxyphenyl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxyphenyl-beta-D-glucopyranosiduronic acid | ChemIDplus |
| 2-hydroxyphenyl β-D-glucosiduronic acid | ChEBI |
| 2-hydroxyphenyl β-D-glucuronide | ChEBI |
| catechol glucuronide | ChEBI |
| catechol β-glucuronide | ChEBI |
| Diphenol glucuronide | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059998 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28151899 | Reaxys |
| CAS:28623-57-6 | ChemIDplus |
| Citations |
|---|