EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCC[C@H](O)[C@@H](O)/C=C/[C@@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+/t15-,16-,17-/m0/s1 |
| InChIKey | MDIUMSLCYIJBQC-MVFSOIOZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinellic acid (CHEBI:34506) has functional parent 13(S)-HPODE (CHEBI:15655) |
| pinellic acid (CHEBI:34506) has role adjuvant (CHEBI:60809) |
| pinellic acid (CHEBI:34506) has role anti-inflammatory agent (CHEBI:67079) |
| pinellic acid (CHEBI:34506) is a TriHOME (CHEBI:73765) |
| Incoming Relation(s) |
| pinellate (CHEBI:747176) is conjugate base of pinellic acid (CHEBI:34506) |
| IUPAC Name |
|---|
| (9S,10E,12S,13S)-9,12,13-trihydroxyoctadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoic acid | KEGG COMPOUND |
| 9,12,13-TriHOME | KEGG COMPOUND |
| 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoic acid | KEGG COMPOUND |
| 9S,12S,13S-trihydroxy-10E-octadecenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C14833 | KEGG COMPOUND |
| HMDB0004708 | HMDB |
| LMFA02000014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4317723 | Reaxys |
| CAS:97134-11-7 | Reaxys |
| Citations |
|---|