EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCC[C@H](O)[C@@H](O)/C=C/[C@@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+/t15-,16-,17-/m0/s1 |
| InChIKey | MDIUMSLCYIJBQC-MVFSOIOZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinellic acid (CHEBI:34506) has functional parent 13(S)-HPODE (CHEBI:15655) |
| pinellic acid (CHEBI:34506) has role adjuvant (CHEBI:60809) |
| pinellic acid (CHEBI:34506) has role anti-inflammatory agent (CHEBI:67079) |
| pinellic acid (CHEBI:34506) is a TriHOME (CHEBI:73765) |
| IUPAC Name |
|---|
| (9S,10E,12S,13S)-9,12,13-trihydroxyoctadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| 9,12,13-TriHOME | KEGG COMPOUND |
| 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoic acid | KEGG COMPOUND |
| (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoic acid | KEGG COMPOUND |
| 9S,12S,13S-trihydroxy-10E-octadecenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C14833 | KEGG COMPOUND |
| LMFA02000014 | LIPID MAPS |
| HMDB0004708 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4317723 | Reaxys |
| CAS:97134-11-7 | Reaxys |
| Citations |
|---|