EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | CCCCC[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h7,9,12,15,17,21H,2-6,8,10-11,13-14,16H2,1H3,(H,19,20)/b9-7-,15-12+/t17-/m0/s1 |
| InChIKey | JDSRHVWSAMTSSN-IRQZEAMPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13(S)-HPODE (CHEBI:15655) has functional parent octadeca-9,11-dienoic acid (CHEBI:36025) |
| 13(S)-HPODE (CHEBI:15655) has role human metabolite (CHEBI:77746) |
| 13(S)-HPODE (CHEBI:15655) is a 13-HPODE (CHEBI:91272) |
| 13(S)-HPODE (CHEBI:15655) is conjugate acid of 13(S)-HPODE(1−) (CHEBI:57466) |
| 13(S)-HPODE (CHEBI:15655) is enantiomer of (13R)-HPODE (CHEBI:39573) |
| Incoming Relation(s) |
| 13(S)-HPODE methyl ester (CHEBI:78040) has functional parent 13(S)-HPODE (CHEBI:15655) |
| pinellic acid (CHEBI:34506) has functional parent 13(S)-HPODE (CHEBI:15655) |
| 13(S)-HPODE(1−) (CHEBI:57466) is conjugate base of 13(S)-HPODE (CHEBI:15655) |
| (13R)-HPODE (CHEBI:39573) is enantiomer of 13(S)-HPODE (CHEBI:15655) |
| IUPAC Name |
|---|
| (9Z,11E,13S)-13-hydroperoxyoctadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 13(S)-HPODE | KEGG COMPOUND |
| 13S-Hydroperoxy-9Z,11E-octadecadienoic acid | KEGG COMPOUND |
| (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoate | KEGG COMPOUND |
| (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoate | KEGG COMPOUND |
| (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000394 | KNApSAcK |
| C04717 | KEGG COMPOUND |
| HMDB0003871 | HMDB |
| LMFA02000034 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3592723 | Reaxys |
| CAS:33964-75-9 | KEGG COMPOUND |