EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33O5 |
| Net Charge | -1 |
| Average Mass | 329.457 |
| Monoisotopic Mass | 329.23335 |
| SMILES | CCCCC[C@H](O)[C@@H](O)/C=C/[C@@H](O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/p-1/b14-13+/t15-,16-,17-/m0/s1 |
| InChIKey | MDIUMSLCYIJBQC-MVFSOIOZSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinellate (CHEBI:747176) is a octadecanoid anion (CHEBI:131860) |
| pinellate (CHEBI:747176) is a TriHOME (CHEBI:73765) |
| pinellate (CHEBI:747176) is conjugate base of pinellic acid (CHEBI:34506) |
| Synonyms | Source |
|---|---|
| 9,12,13-TriHOME(1-) | SUBMITTER |
| FA 18:1(10E;9OH,12OH,13OH) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (9S,12S,13S)-trihydroxy-(10E)-octadecenoate | UniProt |