EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12C[C@@H](O)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-11(20)9-15(18)16(21)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h9,12-14,16-17,21-22H,3-8,10H2,1-2H3/t12-,13-,14-,16+,17-,18+,19-/m0/s1 |
| InChIKey | XSEGWEUVSZRCBC-ZVBLRVHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Changes in the Metabolic Elimination Profile of Testosterone Following Exposure of the Crustacean Daphnia magna to TributyltinGerald A. LeBlanc and James B. McLachlanEcotoxicology and Environmental Safety 45, 296-303 (2000)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6β-hydroxytestosterone (CHEBI:34477) has functional parent testosterone (CHEBI:17347) |
| 6β-hydroxytestosterone (CHEBI:34477) has role Daphnia magna metabolite (CHEBI:83056) |
| 6β-hydroxytestosterone (CHEBI:34477) has role androgen (CHEBI:50113) |
| 6β-hydroxytestosterone (CHEBI:34477) has role human metabolite (CHEBI:77746) |
| 6β-hydroxytestosterone (CHEBI:34477) is a 17β-hydroxy steroid (CHEBI:35343) |
| 6β-hydroxytestosterone (CHEBI:34477) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 6β-hydroxytestosterone (CHEBI:34477) is a 6β-hydroxy steroid (CHEBI:36851) |
| 6β-hydroxytestosterone (CHEBI:34477) is a androstanoid (CHEBI:50402) |
| Incoming Relation(s) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) has functional parent 6β-hydroxytestosterone (CHEBI:34477) |
| IUPAC Name |
|---|
| 6β,17β-dihydroxyandrost-4-en-3-one |
| Synonyms | Source |
|---|---|
| 4-androsten-6β,17β-diol-3-one | ChEBI |
| 6beta,17beta-Dihydroxyandrost-4-en-3-one | KEGG COMPOUND |
| 6beta-Hydroxytestosterone | KEGG COMPOUND |
| (6β,17β)-6,17-dihydroxyandrost-4-en-3-one | IUPAC |
| 6β,17β-dihydroxy-4-androsten-3-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 6β,17β-dihydroxyandrost-4-en-3-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14497 | KEGG COMPOUND |
| HMDB0006259 | HMDB |
| LMST02020054 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2625776 | Reaxys |
| CAS:62-99-7 | KEGG COMPOUND |
| CAS:62-99-7 | ChemIDplus |
| Citations |
|---|