EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@@]12C[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H38O8/c1-24-7-5-12(27)9-16(24)17(32-23-22(31)21(30)20(29)18(11-26)33-23)10-13-14-3-4-19(28)25(14,2)8-6-15(13)24/h9,13-15,17-23,26,28-31H,3-8,10-11H2,1-2H3/t13-,14-,15-,17+,18+,19-,20+,21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | CZISKGRAMZYTOO-LXDCVNORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Changes in the Metabolic Elimination Profile of Testosterone Following Exposure of the Crustacean Daphnia magna to TributyltinGerald A. LeBlanc and James B. McLachlanEcotoxicology and Environmental Safety 45, 296-303 (2000)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) has functional parent 6β-hydroxytestosterone (CHEBI:34477) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) has role Daphnia magna metabolite (CHEBI:83056) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) is a 17β-hydroxy steroid (CHEBI:35343) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) is a monosaccharide derivative (CHEBI:63367) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) is a steroid saponin (CHEBI:61655) |
| glucosyl-6β-hydroxytestosterone (CHEBI:83024) is a α-D-glucoside (CHEBI:22390) |
| IUPAC Name |
|---|
| (6β)-17β-hydroxy-3-oxoandrost-4-en-6-yl α-D-glucopyranoside |