EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19ClN2O |
| Net Charge | 0 |
| Average Mass | 290.794 |
| Monoisotopic Mass | 290.11859 |
| SMILES | CN(C)CCOC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2O/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | OJFSXZCBGQGRNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. antiparkinson drug A drug used in the treatment of Parkinson's disease. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbinoxamine (CHEBI:3398) has role anti-allergic agent (CHEBI:50857) |
| carbinoxamine (CHEBI:3398) has role antiparkinson drug (CHEBI:48407) |
| carbinoxamine (CHEBI:3398) has role H1-receptor antagonist (CHEBI:37955) |
| carbinoxamine (CHEBI:3398) has role muscarinic antagonist (CHEBI:48876) |
| carbinoxamine (CHEBI:3398) is a monochlorobenzenes (CHEBI:83403) |
| carbinoxamine (CHEBI:3398) is a pyridines (CHEBI:26421) |
| carbinoxamine (CHEBI:3398) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| carbinoxamine maleate (CHEBI:31353) has part carbinoxamine (CHEBI:3398) |
| (R)-carbinoxamine (CHEBI:59328) is a carbinoxamine (CHEBI:3398) |
| (S)-carbinoxamine (CHEBI:59329) is a carbinoxamine (CHEBI:3398) |
| IUPAC Name |
|---|
| 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine |
| INNs | Source |
|---|---|
| carbinoxamina | ChemIDplus |
| carbinoxamine | ChemIDplus |
| carbinoxamine | WHO MedNet |
| carbinoxaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| {2-[(4-Chloro-phenyl)-pyridin-2-yl-methoxy]-ethyl}-dimethyl-amine | ChEMBL |
| 2-(p-chloro-α-(2-(dimethylamino)ethoxy)benzyl)pyridine | ChemIDplus |
| (±)-carbinoxamine | ChemIDplus |
| Carbinoxamine | KEGG COMPOUND |
| carbinoxamine base | NIST Chemistry WebBook |
| paracarbinoxamine | ChemIDplus |
| Citations |
|---|