EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19ClN2O.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 406.866 |
| Monoisotopic Mass | 406.12955 |
| SMILES | CN(C)CCOC(c1ccc(Cl)cc1)c1ccccn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19ClN2O.C4H4O4/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-10,16H,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GVNWHCVWDRNXAZ-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. anti-allergic agent A drug used to treat allergic reactions. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbinoxamine maleate (CHEBI:31353) has part carbinoxamine (CHEBI:3398) |
| carbinoxamine maleate (CHEBI:31353) has role anti-allergic agent (CHEBI:50857) |
| carbinoxamine maleate (CHEBI:31353) has role antiparkinson drug (CHEBI:48407) |
| carbinoxamine maleate (CHEBI:31353) has role H1-receptor antagonist (CHEBI:37955) |
| carbinoxamine maleate (CHEBI:31353) has role muscarinic antagonist (CHEBI:48876) |
| carbinoxamine maleate (CHEBI:31353) is a maleate salt (CHEBI:50221) |
| Incoming Relation(s) |
| (S)-carbinoxamine maleate (CHEBI:59330) is a carbinoxamine maleate (CHEBI:31353) |
| IUPAC Name |
|---|
| 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine maleate | ChEBI |
| 2-(p-chloro-α-(2-(dimethylamino)ethoxy)benzyl)pyridine maleate | ChemIDplus |
| p-carbinoxamine maleate | ChemIDplus |
| paracarbinoxamine maleate | ChEBI |