EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59329 - (S)-carbinoxamine
| Formula | C16H19ClN2O |
| Net Charge | 0 |
| Average Mass | 290.794 |
| Monoisotopic Mass | 290.11859 |
| SMILES | CN(C)CCO[C@@H](c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19ClN2O/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13/h3-10,16H,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | OJFSXZCBGQGRNV-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antiparkinson drug A drug used in the treatment of Parkinson's disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-carbinoxamine (CHEBI:59329) is a carbinoxamine (CHEBI:3398) |
| (S)-carbinoxamine (CHEBI:59329) is enantiomer of (R)-carbinoxamine (CHEBI:59328) |
| Incoming Relation(s) |
| (S)-carbinoxamine maleate (CHEBI:59330) has part (S)-carbinoxamine (CHEBI:59329) |
| (R)-carbinoxamine (CHEBI:59328) is enantiomer of (S)-carbinoxamine (CHEBI:59329) |
| IUPAC Name |
|---|
| 2-[(S)-(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine |
| INN | Source |
|---|---|
| rotoxamine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (−)-2-(p-chloro-α-(2-(dimethylamino)ethoxy)benzyl)pyridine | ChemIDplus |
| rotoxamina | ChemIDplus |
| rotoxaminum | ChemIDplus |
| (S)-(−)-carbinoxamine | ChEBI |
| (−)-carbinoxamine | ChEBI |
| levocarbinoxamine | ChEBI |