EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:189529 - nitrosocarbaryl
| Formula | C12H10N2O3 |
| Net Charge | 0 |
| Average Mass | 230.223 |
| Monoisotopic Mass | 230.06914 |
| SMILES | CN(N=O)C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10N2O3/c1-14(13-16)12(15)17-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3 |
| InChIKey | FFSXTYIBUNXZMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrosocarbaryl (CHEBI:189529) has functional parent carbaryl (CHEBI:3390) |
| nitrosocarbaryl (CHEBI:189529) has role carcinogenic agent (CHEBI:50903) |
| nitrosocarbaryl (CHEBI:189529) has role mutagen (CHEBI:25435) |
| nitrosocarbaryl (CHEBI:189529) is a carbamate ester (CHEBI:23003) |
| nitrosocarbaryl (CHEBI:189529) is a naphthalenes (CHEBI:25477) |
| nitrosocarbaryl (CHEBI:189529) is a nitroso compound (CHEBI:35800) |
| IUPAC Name |
|---|
| naphthalen-1-yl methyl(nitroso)carbamate |
| Synonyms | Source |
|---|---|
| 1-naphthalenyl methylnitrosocarbamate | ChemIDplus |
| 1-naphthyl methylnitrosocarbamate | ChemIDplus |
| 1-naphthyl N-methyl-N-nitrosocarbamate | ChemIDplus |
| methyl-nitrosocarbamic acid 1-naphthyl ester | ChemIDplus |
| N-nitrosocarbaryl | ChemIDplus |
| 1-naphthalenyl N-methyl-N-nitrosocarbamate | ChEBI |
| Citations |
|---|