EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)CC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChIKey | HWXBTNAVRSUOJR-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role algal metabolite (CHEBI:84735) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role biomarker (CHEBI:59163) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) has role human metabolite (CHEBI:77746) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is a 2-hydroxyglutaric acid (CHEBI:17084) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is conjugate acid of (R)-2-hydroxyglutarate(2−) (CHEBI:15801) |
| (R)-2-hydroxyglutaric acid (CHEBI:32796) is enantiomer of (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| Incoming Relation(s) |
| (R)-2-hydroxyglutarate(2−) (CHEBI:15801) is conjugate base of (R)-2-hydroxyglutaric acid (CHEBI:32796) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is enantiomer of (R)-2-hydroxyglutaric acid (CHEBI:32796) |
| IUPAC Name |
|---|
| (2R)-2-hydroxypentanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-D-glutaric acid | HMDB |
| (2R)-hydroxyglutaric acid | ChEBI |
| (R)-(−)-2-hydroxyglutaric acid | ChEBI |
| (R)-2-hydroxyglutaric acid | ChEBI |
| (R)-2-hydroxy-pentanedioic acid | HMDB |
| (R)-2-hydroxypentanedioic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2HG | PDBeChem |
| C01087 | KEGG COMPOUND |
| FDB022139 | FooDB |
| HMDB0000606 | HMDB |
| R-2-HYDROXYGLUTARATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723806 | Reaxys |
| CAS:13095-47-1 | ChEBI |
| Citations |
|---|