EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3387 - carbamazepine
| Formula | C15H12N2O |
| Net Charge | 0 |
| Average Mass | 236.274 |
| Monoisotopic Mass | 236.09496 |
| SMILES | NC(=O)N1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18) |
| InChIKey | FFGPTBGBLSHEPO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. sodium channel blocker An agent that inhibits sodium influx through cell membranes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. drug allergen Any drug which causes the onset of an allergic reaction. mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. anticonvulsant A drug used to prevent seizures or reduce their severity. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. drug allergen Any drug which causes the onset of an allergic reaction. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbamazepine (CHEBI:3387) has role analgesic (CHEBI:35480) |
| carbamazepine (CHEBI:3387) has role anticonvulsant (CHEBI:35623) |
| carbamazepine (CHEBI:3387) has role antimanic drug (CHEBI:35477) |
| carbamazepine (CHEBI:3387) has role drug allergen (CHEBI:88188) |
| carbamazepine (CHEBI:3387) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| carbamazepine (CHEBI:3387) has role environmental contaminant (CHEBI:78298) |
| carbamazepine (CHEBI:3387) has role glutamate transporter activator (CHEBI:64370) |
| carbamazepine (CHEBI:3387) has role mitogen (CHEBI:52290) |
| carbamazepine (CHEBI:3387) has role non-narcotic analgesic (CHEBI:35481) |
| carbamazepine (CHEBI:3387) has role sodium channel blocker (CHEBI:38633) |
| carbamazepine (CHEBI:3387) has role xenobiotic (CHEBI:35703) |
| carbamazepine (CHEBI:3387) is a dibenzoazepine (CHEBI:47804) |
| carbamazepine (CHEBI:3387) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has functional parent carbamazepine (CHEBI:3387) |
| licarbazepine (CHEBI:701) has functional parent carbamazepine (CHEBI:3387) |
| IUPAC Name |
|---|
| 5H-dibenzo[b,f]azepine-5-carboxamide |
| INNs | Source |
|---|---|
| carbamazepina | ChemIDplus |
| carbamazepine | ChemIDplus |
| carbamazepinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-carbamoyl-5H-dibenz[b,f]azepine | NIST Chemistry WebBook |
| 5-Carbamoyl-5H-dibenz(b,f)azepine | ChemIDplus |
| 5-Carbamoyl-5H-dibenzo(b,f)azepine | ChemIDplus |
| 5-Carbamyl-5H-dibenzo(b,f)azepine | ChemIDplus |
| 5H-Dibenz(b,f)azepine-5-carboxamide | ChemIDplus |
| Carbamazepen | ChemIDplus |
| Brand Name | Source |
|---|---|
| Carnexiv | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 489 | DrugCentral |
| C06868 | KEGG COMPOUND |
| Carbamazepine | Wikipedia |
| D00252 | KEGG DRUG |
| DB00564 | DrugBank |
| HMDB0014704 | HMDB |
| LSM-3610 | LINCS |
| US2004220187 | Patent |
| US2007167446 | Patent |
| US2011177136 | Patent |
| US2011245283 | Patent |
| US2948718 | Patent |
| Citations |
|---|