EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O |
| Net Charge | 0 |
| Average Mass | 236.274 |
| Monoisotopic Mass | 236.09496 |
| SMILES | NC(=O)N1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18) |
| InChIKey | FFGPTBGBLSHEPO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. drug allergen Any drug which causes the onset of an allergic reaction. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. sodium channel blocker An agent that inhibits sodium influx through cell membranes. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | glutamate transporter activator A neurotransmitter transporter modulator that activates glutamate transporters. drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbamazepine (CHEBI:3387) has role analgesic (CHEBI:35480) |
| carbamazepine (CHEBI:3387) has role anticonvulsant (CHEBI:35623) |
| carbamazepine (CHEBI:3387) has role antimanic drug (CHEBI:35477) |
| carbamazepine (CHEBI:3387) has role drug allergen (CHEBI:88188) |
| carbamazepine (CHEBI:3387) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| carbamazepine (CHEBI:3387) has role environmental contaminant (CHEBI:78298) |
| carbamazepine (CHEBI:3387) has role glutamate transporter activator (CHEBI:64370) |
| carbamazepine (CHEBI:3387) has role mitogen (CHEBI:52290) |
| carbamazepine (CHEBI:3387) has role non-narcotic analgesic (CHEBI:35481) |
| carbamazepine (CHEBI:3387) has role sodium channel blocker (CHEBI:38633) |
| carbamazepine (CHEBI:3387) has role xenobiotic (CHEBI:35703) |
| carbamazepine (CHEBI:3387) is a dibenzoazepine (CHEBI:47804) |
| carbamazepine (CHEBI:3387) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has functional parent carbamazepine (CHEBI:3387) |
| licarbazepine (CHEBI:701) has functional parent carbamazepine (CHEBI:3387) |
| IUPAC Name |
|---|
| 5H-dibenzo[b,f]azepine-5-carboxamide |
| INNs | Source |
|---|---|
| carbamazepina | ChemIDplus |
| carbamazepinum | ChemIDplus |
| carbamazepine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Carbamoyl-5H-dibenz(b,f)azepine | ChemIDplus |
| 5-Carbamoyl-5H-dibenzo(b,f)azepine | ChemIDplus |
| 5-Carbamyl-5H-dibenzo(b,f)azepine | ChemIDplus |
| 5H-Dibenz(b,f)azepine-5-carboxamide | ChemIDplus |
| Carbamazepen | ChemIDplus |
| 5-carbamoyl-5H-dibenz[b,f]azepine | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Carnexiv | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06868 | KEGG COMPOUND |
| DB00564 | DrugBank |
| D00252 | KEGG DRUG |
| Carbamazepine | Wikipedia |
| US2011177136 | Patent |
| US2007167446 | Patent |
| US2011245283 | Patent |
| US2004220187 | Patent |
| US2948718 | Patent |
| HMDB0014704 | HMDB |
| LSM-3610 | LINCS |
| 489 | DrugCentral |
| Citations |
|---|