EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O2 |
| Net Charge | 0 |
| Average Mass | 254.289 |
| Monoisotopic Mass | 254.10553 |
| SMILES | NC(=O)N1c2ccccc2CC(O)c2ccccc21 |
| InChI | InChI=1S/C15H14N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8,14,18H,9H2,(H2,16,19) |
| InChIKey | BMPDWHIDQYTSHX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| licarbazepine (CHEBI:701) has functional parent carbamazepine (CHEBI:3387) |
| licarbazepine (CHEBI:701) has role anticonvulsant (CHEBI:35623) |
| licarbazepine (CHEBI:701) has role drug allergen (CHEBI:88188) |
| licarbazepine (CHEBI:701) has role sodium channel blocker (CHEBI:38633) |
| licarbazepine (CHEBI:701) is a carboxamide (CHEBI:37622) |
| licarbazepine (CHEBI:701) is a dibenzoazepine (CHEBI:47804) |
| licarbazepine (CHEBI:701) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| eslicarbazepine acetate (CHEBI:87016) has functional parent licarbazepine (CHEBI:701) |
| IUPAC Name |
|---|
| 10-hydroxy-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide |
| INN | Source |
|---|---|
| licarbazepine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10,11-Dihydro-10-hydroxycarbamazepine | ChemIDplus |
| 10-Hydroxycarbamazepine | KEGG COMPOUND |
| 10-Hydroxycarbazepine | KEGG COMPOUND |
| GP 47779 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07493 | KEGG COMPOUND |
| Licarbazepine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1540211 | Reaxys |
| CAS:29331-92-8 | KEGG COMPOUND |
| CAS:29331-92-8 | ChemIDplus |
| Citations |
|---|