EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | NC(=O)N1c2ccccc2C2OC2c2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c16-15(18)17-11-7-3-1-5-9(11)13-14(19-13)10-6-2-4-8-12(10)17/h1-8,13-14H,(H2,16,18) |
| InChIKey | ZRWWEEVEIOGMMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has functional parent carbamazepine (CHEBI:3387) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role allergen (CHEBI:50904) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role drug metabolite (CHEBI:49103) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role marine xenobiotic metabolite (CHEBI:83399) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a dibenzoazepine (CHEBI:47804) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a epoxide (CHEBI:32955) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1a,10b-dihydro-6H-dibenzo[b,f]oxireno[d]azepine-6-carboxamide |
| Synonyms | Source |
|---|---|
| 10,11-Epoxycarbamazepine | ChemIDplus |
| Carbamazepine 10,11-oxide | ChemIDplus |
| Carbamazepine epoxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07496 | KEGG COMPOUND |
| HMDB0060658 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1219988 | Reaxys |
| CAS:36507-30-9 | ChemIDplus |
| CAS:36507-30-9 | KEGG COMPOUND |
| Citations |
|---|