EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | NC(=O)N1c2ccccc2C2OC2c2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c16-15(18)17-11-7-3-1-5-9(11)13-14(19-13)10-6-2-4-8-12(10)17/h1-8,13-14H,(H2,16,18) |
| InChIKey | ZRWWEEVEIOGMMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has functional parent carbamazepine (CHEBI:3387) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role allergen (CHEBI:50904) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role drug metabolite (CHEBI:49103) |
| carbamazepine-10,11-epoxide (CHEBI:3388) has role marine xenobiotic metabolite (CHEBI:83399) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a dibenzoazepine (CHEBI:47804) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a epoxide (CHEBI:32955) |
| carbamazepine-10,11-epoxide (CHEBI:3388) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1a,10b-dihydro-6H-dibenzo[b,f]oxireno[d]azepine-6-carboxamide |
| Synonyms | Source |
|---|---|
| 10,11-Epoxycarbamazepine | ChemIDplus |
| Carbamazepine 10,11-oxide | ChemIDplus |
| Carbamazepine epoxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07496 | KEGG COMPOUND |
| HMDB0060658 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1219988 | Reaxys |
| CAS:36507-30-9 | ChemIDplus |
| CAS:36507-30-9 | KEGG COMPOUND |
| Citations |
|---|