EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O3 |
| Net Charge | 0 |
| Average Mass | 226.231 |
| Monoisotopic Mass | 226.06299 |
| SMILES | O=C1c2c(O)cccc2Cc2cccc(O)c21 |
| InChI | InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 |
| InChIKey | NUZWLKWWNNJHPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthralin (CHEBI:37510) has functional parent anthrone (CHEBI:33835) |
| anthralin (CHEBI:37510) has role antipsoriatic (CHEBI:50748) |
| anthralin (CHEBI:37510) is a anthracenes (CHEBI:46955) |
| anthralin (CHEBI:37510) is tautomer of anthracene-1,8,9-triol (CHEBI:2756) |
| Incoming Relation(s) |
| chrysophanol-9-anthrone (CHEBI:3686) has functional parent anthralin (CHEBI:37510) |
| anthracene-1,8,9-triol (CHEBI:2756) is tautomer of anthralin (CHEBI:37510) |
| IUPAC Name |
|---|
| 1,8-dihydroxyanthracen-9(10H)-one |
| Synonyms | Source |
|---|---|
| 1,8-dihydroxy-9(10H)-anthracenone | NIST Chemistry WebBook |
| dithranol | ChemIDplus |
| 1,8-dihydroxyanthrone | ChemIDplus |
| 1,8-dihydroxy-9-anthrone | NIST Chemistry WebBook |
| Anthralin | KEGG COMPOUND |
| Citations |
|---|