EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N6O5S |
| Net Charge | +1 |
| Average Mass | 399.453 |
| Monoisotopic Mass | 399.14452 |
| SMILES | C[S@+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27+/m0/s1 |
| InChIKey | MEFKEPWMEQBLKI-TYYLHDHTSA-O |
| Roles Classification |
|---|
| Biological Roles: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-S-adenosyl-L-methionine (CHEBI:33440) is a S-adenosyl-L-methionine (CHEBI:15414) |
| (R)-S-adenosyl-L-methionine (CHEBI:33440) is tautomer of (R)-S-adenosyl-L-methionine zwitterion (CHEBI:142093) |
| Incoming Relation(s) |
| (R)-S-adenosyl-L-methionine zwitterion (CHEBI:142093) is tautomer of (R)-S-adenosyl-L-methionine (CHEBI:33440) |
| IUPAC Name |
|---|
| (R)-[(3S)-3-amino-3-carboxypropyl](5'-deoxyadenosin-5'-yl)(methyl)sulfonium |
| Synonym | Source |
|---|---|
| (R,S)-AdoMet | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9671724 | Beilstein |
| Citations |
|---|