EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N6O5S |
| Net Charge | +1 |
| Average Mass | 399.453 |
| Monoisotopic Mass | 399.14452 |
| SMILES | C[S@+](CC[C@H]([NH3+])C(=O)[O-])C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/p+1/t7-,8+,10+,11+,14+,27+/m0/s1 |
| InChIKey | MEFKEPWMEQBLKI-TYYLHDHTSA-O |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-S-adenosyl-L-methionine zwitterion (CHEBI:142093) is a S-adenosyl-L-methionine zwitterion (CHEBI:59789) |
| (R)-S-adenosyl-L-methionine zwitterion (CHEBI:142093) is tautomer of (R)-S-adenosyl-L-methionine (CHEBI:33440) |
| Incoming Relation(s) |
| (R)-S-adenosyl-L-methionine (CHEBI:33440) is tautomer of (R)-S-adenosyl-L-methionine zwitterion (CHEBI:142093) |
| Synonyms | Source |
|---|---|
| (R,S)-AdoMet | SUBMITTER |
| (R,S)-AdoMet zwitterion | ChEBI |
| (R,S)-S-adenosyl-L-methionine zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (R)-S-adenosyl-L-methionine | UniProt |
| Citations |
|---|