EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32978 - (R)-3-phenyllactic acid
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | O=C(O)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | VOXXWSYKYCBWHO-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-phenyllactic acid (CHEBI:32978) is a (2R)-2-hydroxy monocarboxylic acid (CHEBI:17893) |
| (R)-3-phenyllactic acid (CHEBI:32978) is a 3-phenyllactic acid (CHEBI:25998) |
| (R)-3-phenyllactic acid (CHEBI:32978) is conjugate acid of (R)-3-phenyllactate (CHEBI:11009) |
| (R)-3-phenyllactic acid (CHEBI:32978) is enantiomer of (S)-3-phenyllactic acid (CHEBI:43065) |
| Incoming Relation(s) |
| (R)-3-phenyllactate (CHEBI:11009) is conjugate base of (R)-3-phenyllactic acid (CHEBI:32978) |
| (S)-3-phenyllactic acid (CHEBI:43065) is enantiomer of (R)-3-phenyllactic acid (CHEBI:32978) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| (R)-Phenyllactate | KEGG COMPOUND |
| D-3-phenyllactic acid | ChEBI |